Naam product |
4-Bromobenzamide |
Synoniemen |
4-Bromobenzamide,97%; p-bromo-benzamid; p-bromobenzoicacidamide; P-BROMOBENZAMIDE |
MF |
C7H6BrNO |
Molecuulgewicht |
200.0326 |
InChI |
InChI=1/C7H6BrNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10) |
CAS-nummer |
698-67-9 |
EINECS |
211-817-9 |
Moleculaire Structuur |
|
Dichtheid |
1.609g/cm3 |
Smeltpunt |
189-194℃ |
Kookpunt |
309.9°C at 760 mmHg |
Brekingsindex |
1.605 |
Vlampunt |
141.2°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|