Naam product |
Bromochloroacetonitrile |
Synoniemen |
Bromochloromethyl cyanide; CCRIS 2672; HSDB 7617; Acetonitrile, bromochloro- |
MF |
C2HBrClN |
Molecuulgewicht |
154.393 |
InChI |
InChI=1/C2HBrClN/c3-2(4)1-5/h2H |
CAS-nummer |
83463-62-1 |
Moleculaire Structuur |
|
Dichtheid |
1.932g/cm3 |
Kookpunt |
121.1°C at 760 mmHg |
Brekingsindex |
1.506 |
Vlampunt |
27.1°C |
Risico-codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|