Naam product |
tris(2,6-dimethoxyphenyl)phosphine |
Synoniemen |
Tris(2,6-dimethoxyphenly)phosphine; TDMPP; tris(2,6-dimethoxyphenyl)phosphane |
MF |
C24H27O6P |
Molecuulgewicht |
442.4413 |
InChI |
InChI=1/C24H27O6P/c1-25-16-10-7-11-17(26-2)22(16)31(23-18(27-3)12-8-13-19(23)28-4)24-20(29-5)14-9-15-21(24)30-6/h7-15H,1-6H3 |
CAS-nummer |
85417-41-0 |
Moleculaire Structuur |
|
Smeltpunt |
145-147℃ |
Kookpunt |
566.4°C at 760 mmHg |
Vlampunt |
372.2°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|