produktnavn |
4-Piperidinoacetophenone |
Synonymer |
N-(4-Acetylphenyl)piperidine; 1-[4-(piperidin-1-yl)phenyl]ethanone; 4'-PIPERIDINOACETOPHENONE |
Molekylær Formel |
C13H17NO |
Molekylvekt |
203.2802 |
InChI |
InChI=1/C13H17NO/c1-11(15)12-5-7-13(8-6-12)14-9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
CAS-nummer |
10342-85-5 |
EINECS |
233-746-2 |
Molecular Structure |
|
Tetthet |
1.052g/cm3 |
Smeltepunkt |
84-90℃ |
Kokepunkt |
357.8°C at 760 mmHg |
Brytningsindeks |
1.545 |
Flammepunktet |
140.2°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|