produktnavn |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
Molekylær Formel |
C7H11FO2 |
Molekylvekt |
146.1594 |
InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
CAS-nummer |
1171-47-7 |
Molecular Structure |
|
Tetthet |
1.159g/cm3 |
Kokepunkt |
227.566°C at 760 mmHg |
Brytningsindeks |
1.454 |
Flammepunktet |
91.429°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|