produktnavn |
2-bromo-4-hydroxymethylpyridine |
Synonymer |
2-Bromo-4-(hydroxymethyl)pyridine; 2-Bromopyridine-4-methanol; (2-bromopyridin-4-yl)methanol |
Molekylær Formel |
C6H6BrNO |
Molekylvekt |
188.0219 |
InChI |
InChI=1/C6H6BrNO/c7-6-3-5(4-9)1-2-8-6/h1-3,9H,4H2 |
CAS-nummer |
118289-16-0 |
Molecular Structure |
|
Tetthet |
1.668g/cm3 |
Kokepunkt |
316.6°C at 760 mmHg |
Brytningsindeks |
1.598 |
Flammepunktet |
145.3°C |
Hazard symboler |
Xi:;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|