produktnavn |
5-(2,6-dichloro-4-pyridyl)-1,3,4-oxadiazole-2-thiol |
Synonymer |
5-(2,6-dichloropyridin-4-yl)-1,3,4-oxadiazole-2(3H)-thione |
Molekylær Formel |
C7H3Cl2N3OS |
Molekylvekt |
248.0892 |
InChI |
InChI=1/C7H3Cl2N3OS/c8-4-1-3(2-5(9)10-4)6-11-12-7(14)13-6/h1-2H,(H,12,14) |
CAS-nummer |
119221-62-4 |
Molecular Structure |
|
Tetthet |
1.82g/cm3 |
Smeltepunkt |
205℃ |
Kokepunkt |
358.9°C at 760 mmHg |
Brytningsindeks |
1.773 |
Flammepunktet |
170.9°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|