produktnavn |
1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile |
Synonymer |
1-(4-Methoxyphenyl)cyclopentanecarbonitrile |
Molekylær Formel |
C13H15NO |
Molekylvekt |
201.2643 |
InChI |
InChI=1/C13H15NO/c1-15-12-6-4-11(5-7-12)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
CAS-nummer |
1206-15-1 |
EINECS |
214-890-5 |
Molecular Structure |
|
Tetthet |
1.07g/cm3 |
Kokepunkt |
346.4°C at 760 mmHg |
Brytningsindeks |
1.543 |
Flammepunktet |
146.2°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|