produktnavn |
N-Ethyldiethanolamine |
Synonymer |
2,2-(Ethylimino)diethanol; Ethyldiethanolamine; N-ethyl-2-hydroxy-N-(2-hydroxyethyl)ethanaminium |
Molekylær Formel |
C6H16NO2 |
Molekylvekt |
134.1962 |
InChI |
InChI=1/C6H15NO2/c1-2-7(3-5-8)4-6-9/h8-9H,2-6H2,1H3/p+1 |
CAS-nummer |
139-87-7 |
EINECS |
205-379-8 |
Molecular Structure |
|
Smeltepunkt |
-50℃ |
Kokepunkt |
246.4°C at 760 mmHg |
Flammepunktet |
123.9°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|