produktnavn |
1-(2-Cyanoethyl)-3-(trifluoromethyl)pyrid-2(1H)-one |
Synonymer |
3-[2-Oxo-3-(trifluoromethyl)-1,2-dihydropyridin-1-yl]propanenitrile; 1-(2-Cyanoethyl)-3-(trifluoromethyl)-2(1H)-pyridone; [(2,4-difluorophenyl)sulfanyl]acetonitrile |
Molekylær Formel |
C8H5F2NS |
Molekylvekt |
185.1938 |
InChI |
InChI=1/C8H5F2NS/c9-6-1-2-8(7(10)5-6)12-4-3-11/h1-2,5H,4H2 |
CAS-nummer |
175277-60-8 |
Molecular Structure |
|
Tetthet |
1.31g/cm3 |
Smeltepunkt |
88-89℃ |
Kokepunkt |
242.4°C at 760 mmHg |
Brytningsindeks |
1.542 |
Flammepunktet |
100.4°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|