produktnavn |
2,6-Dimethyl-3,5-heptanedione |
Synonymer |
2,6-dimethylheptane-3,5-dione; (4Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one |
Molekylær Formel |
C9H16O2 |
Molekylvekt |
156.2221 |
InChI |
InChI=1/C9H16O2/c1-6(2)8(10)5-9(11)7(3)4/h5-7,10H,1-4H3/b8-5- |
CAS-nummer |
18362-64-6 |
EINECS |
242-234-8 |
Molecular Structure |
|
Tetthet |
0.941g/cm3 |
Kokepunkt |
239.2°C at 760 mmHg |
Brytningsindeks |
1.456 |
Flammepunktet |
97.8°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|