| produktnavn |
1-Bromo-3,3-diphenylpropane |
| Synonymer |
3,3-Diphenylpropyl bromide; 1,1'-(3-bromopropane-1,1-diyl)dibenzene |
| Molekylær Formel |
C15H15Br |
| Molekylvekt |
275.1836 |
| InChI |
InChI=1/C15H15Br/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
| CAS-nummer |
20017-68-9 |
| EINECS |
243-467-8 |
| Molecular Structure |
|
| Tetthet |
1.275g/cm3 |
| Smeltepunkt |
39-42℃ |
| Kokepunkt |
317.4°C at 760 mmHg |
| Brytningsindeks |
1.587 |
| Flammepunktet |
143.2°C |
| Hazard symboler |
 C:Corrosive;
|
| Risiko Koder |
R34:Causes burns.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|
