| produktnavn |
3-Amino-4-chloropyridine |
| Synonymer |
4-Chloro-3-pyridinamine; 4-Chloro-3-aminopyridine; 4-chloropyridin-3-amine; 4-CHLORO-PYRIDIN-3-YLAMINE |
| Molekylær Formel |
C5H5ClN2 |
| Molekylvekt |
128.5596 |
| InChI |
InChI=1/C5H5ClN2/c6-4-1-2-8-3-5(4)7/h1-3H,7H2 |
| CAS-nummer |
20511-15-3 |
| Molecular Structure |
|
| Tetthet |
1.326g/cm3 |
| Kokepunkt |
247.6°C at 760 mmHg |
| Brytningsindeks |
1.607 |
| Flammepunktet |
103.5°C |
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
