produktnavn |
2,3,6-trifluoroacetophenone |
Synonymer |
2',3',6'-trifluoroacetophenone; 1-(2,3,6-trifluorophenyl)ethanone |
Molekylær Formel |
C8H5F3O |
Molekylvekt |
174.1199 |
InChI |
InChI=1/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
CAS-nummer |
208173-22-2 |
Molecular Structure |
|
Tetthet |
1.303g/cm3 |
Kokepunkt |
187.2°C at 760 mmHg |
Brytningsindeks |
1.455 |
Flammepunktet |
65°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|