| produktnavn |
2,2-Dichloroacetophenone |
| Synonymer |
2,2-Dichloro-1-phenylethanone; alpha,alpha-Dichloroacetophenone; Phenacylidene chloride |
| Molekylær Formel |
C8H6Cl2O |
| Molekylvekt |
189.0386 |
| InChI |
InChI=1/C8H6Cl2O/c9-8(10)7(11)6-4-2-1-3-5-6/h1-5,8H |
| CAS-nummer |
2648-61-5 |
| Molecular Structure |
|
| Tetthet |
1.311g/cm3 |
| Smeltepunkt |
21℃ |
| Kokepunkt |
252.3°C at 760 mmHg |
| Brytningsindeks |
1.55 |
| Flammepunktet |
103.6°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
