| produktnavn |
1-(1-Piperidino)cyclohexene |
| Synonymer |
1-(Cyclohexen-1-yl)piperidine; 1-(cyclohex-1-en-1-yl)piperidine; 1-Piperidino-1-cyclohexene |
| Molekylær Formel |
C11H19N |
| Molekylvekt |
165.2753 |
| InChI |
InChI=1/C11H19N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h7H,1-6,8-10H2 |
| CAS-nummer |
2981-10-4 |
| Molecular Structure |
|
| Tetthet |
0.978g/cm3 |
| Kokepunkt |
262.2°C at 760 mmHg |
| Brytningsindeks |
1.527 |
| Flammepunktet |
102.8°C |
| Risiko Koder |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
