| produktnavn |
dl-alpha-lipoamide |
| Synonymer |
dl-6,8-thioctic acid amide; 5-(dithiolan-3-yl)valeramide; Thioctamide; DL-6,8-Thioctamide; 1,2-Dithiolane-3-valeramide; DL-6,8-Dithiooctanoic acid amide; alpha-Lipoic acid amide; alpha-Lipoic amide; (?-alpha-Lipoamide; Thioctic Amide; 1,2-Dithioane-3-Pentanamide; DL-α-lipoamide; DL-6-Thioctic amide; DL-5-(1,2-Dithiolan-3-yl)valeramide; 5-(1,2-dithiolan-3-yl)pentanamide; N'-(pyridin-4-ylcarbonyl)pyridine-4-carbohydrazide |
| Molekylær Formel |
C12H10N4O2 |
| Molekylvekt |
242.2334 |
| InChI |
InChI=1/C12H10N4O2/c17-11(9-1-5-13-6-2-9)15-16-12(18)10-3-7-14-8-4-10/h1-8H,(H,15,17)(H,16,18) |
| CAS-nummer |
3206-73-3 |
| EINECS |
221-710-9 |
| Molecular Structure |
|
| Tetthet |
1.313g/cm3 |
| Smeltepunkt |
128-131℃ |
| Kokepunkt |
551.5°C at 760 mmHg |
| Brytningsindeks |
1.617 |
| Flammepunktet |
287.3°C |
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
