produktnavn |
3-Bromobenzhydrazide |
Synonymer |
3-Bromobenzoic hydrazide; (3-Bromobenzoyl)hydrazine; (m-Bromobenzoyl)hydrazine; 3-Bromobenzohydrazide; Benzoic acid, 3-bromo-, hydrazide; Benzoic acid, m-bromo-, hydrazide; m-Bromobenzohydrazide; m-Bromobenzoic acid hydrazide; m-Bromobenzoic hydrazide |
Molekylær Formel |
C7H7BrN2O |
Molekylvekt |
215.0473 |
InChI |
InChI=1/C7H7BrN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
CAS-nummer |
39115-96-3 |
EINECS |
254-298-4 |
Molecular Structure |
|
Tetthet |
1.615g/cm3 |
Smeltepunkt |
155-156℃ |
Kokepunkt |
368.5°C at 760 mmHg |
Brytningsindeks |
1.615 |
Flammepunktet |
176.7°C |
Hazard symboler |
Xi:;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|