produktnavn |
5-fluoro-2-nitrobenzaldehyde |
Synonymer |
2-Nitro-5-Fluorobenzaldehyde; 5-Fluoro-2-nitrobenzadehyde |
Molekylær Formel |
C8H7FO3 |
Molekylvekt |
170.1378 |
InChI |
InChI=1/C8H7FO3/c1-12-7-4-5(9)2-3-6(7)8(10)11/h2-4H,1H3,(H,10,11) |
CAS-nummer |
395-81-3 |
EINECS |
206-903-8 |
Molecular Structure |
|
Tetthet |
1.307g/cm3 |
Smeltepunkt |
92-94℃ |
Kokepunkt |
266.9°C at 760 mmHg |
Brytningsindeks |
1.524 |
Flammepunktet |
115.2°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|