produktnavn |
Methylphenylpiperazine |
Synonymer |
1-(4-Methylphenyl)piperazine; N-(p-Tolyl)piperazine; 1-p-tolylpiperazine |
Molekylær Formel |
C11H16N2 |
Molekylvekt |
176.2581 |
InChI |
InChI=1/C11H16N2/c1-10-2-4-11(5-3-10)13-8-6-12-7-9-13/h2-5,12H,6-9H2,1H3 |
CAS-nummer |
39593-08-3 |
EINECS |
254-534-6 |
Molecular Structure |
|
Tetthet |
1.012g/cm3 |
Kokepunkt |
321.2°C at 760 mmHg |
Brytningsindeks |
1.54 |
Flammepunktet |
153.8°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|