produktnavn |
1-Phenylpyrrolidine |
Synonymer |
1-phenyl-pyrrolidine |
Molekylær Formel |
C10H13N |
Molekylvekt |
147.2169 |
InChI |
InChI=1/C10H13N/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-3,6-7H,4-5,8-9H2 |
CAS-nummer |
4096-21-3 |
EINECS |
223-849-0 |
Molecular Structure |
|
Tetthet |
1.022g/cm3 |
Kokepunkt |
237.8°C at 760 mmHg |
Brytningsindeks |
1.558 |
Flammepunktet |
89°C |
Risiko Koder |
R21/22:Harmful in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|