produktnavn |
2-Chloro-3-methoxypyridine |
Molekylær Formel |
C6H6ClNO |
Molekylvekt |
143.5709 |
InChI |
InChI=1/C6H6ClNO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3 |
CAS-nummer |
52605-96-6 |
EINECS |
258-039-6 |
Molecular Structure |
|
Tetthet |
1.21g/cm3 |
Kokepunkt |
210.6°C at 760 mmHg |
Brytningsindeks |
1.517 |
Flammepunktet |
81.2°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|