| produktnavn |
5-Chloro-2,3-dihydroxypyridine |
| Synonymer |
5-Chloropyridine-2,3-diol; 5-chloro-3-hydroxypyridin-2(1H)-one |
| Molekylær Formel |
C5H4ClNO2 |
| Molekylvekt |
145.5438 |
| InChI |
InChI=1/C5H4ClNO2/c6-3-1-4(8)5(9)7-2-3/h1-2,8H,(H,7,9) |
| CAS-nummer |
53233-89-9 |
| EINECS |
258-441-1 |
| Molecular Structure |
|
| Tetthet |
1.56g/cm3 |
| Smeltepunkt |
295℃ |
| Kokepunkt |
297.6°C at 760 mmHg |
| Brytningsindeks |
1.617 |
| Flammepunktet |
133.8°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
