produktnavn |
4-Heptanol |
Synonymer |
Dipropylcarbinol; heptan-4-ol |
Molekylær Formel |
C7H16O |
Molekylvekt |
116.2013 |
InChI |
InChI=1/C7H16O/c1-3-5-7(8)6-4-2/h7-8H,3-6H2,1-2H3 |
CAS-nummer |
589-55-9 |
EINECS |
209-651-7 |
Molecular Structure |
|
Tetthet |
0.818g/cm3 |
Kokepunkt |
161.3°C at 760 mmHg |
Brytningsindeks |
1.42 |
Flammepunktet |
61.8°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R10:Flammable.;
R36:Irritating to eyes.;
|
Sikkerhet Beskrivelse |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|