| produktnavn |
2-Iodo-m-xylene |
| Synonymer |
2-Iodo-1,3-Dimethylbenzene |
| Molekylær Formel |
C8H9I |
| Molekylvekt |
232.0615 |
| InChI |
InChI=1/C8H9I/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
| CAS-nummer |
608-28-6 |
| EINECS |
210-158-4 |
| Molecular Structure |
|
| Tetthet |
1.61g/cm3 |
| Kokepunkt |
227.5°C at 760 mmHg |
| Brytningsindeks |
1.592 |
| Flammepunktet |
98.1°C |
| Vannløselighet |
insoluble |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection;
|
|
