| produktnavn |
2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde |
| Synonymer |
2,2-Difluoro-5-formyl-1,3-benzodioxole; 2,2-difluoro-1,3-benzodioxole-5-carbaldehyde; 2,2-Difluorobenzodioxole-5-Carboxaldehyde; 2,2-Difluoro-5-formylbenzodioxole;
|
| Molekylær Formel |
C8H4F2O3 |
| Molekylvekt |
186.1124 |
| InChI |
InChI=1/C8H4F2O3/c9-8(10)12-6-2-1-5(4-11)3-7(6)13-8/h1-4H |
| CAS-nummer |
656-42-8 |
| Molecular Structure |
|
| Tetthet |
1.5g/cm3 |
| Kokepunkt |
210.5°C at 760 mmHg |
| Brytningsindeks |
1.525 |
| Flammepunktet |
79.1°C |
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
