| produktnavn |
1-(3-Chlorophenyl)piperazine |
| Synonymer |
3-Chlorphenylpiperazine; 1-(3-Chlorphenyl)-piperazine; 3-Chlorophenyl piperazine; 1-(3-Chlorophenyl)-piperazine |
| Molekylær Formel |
C10H13ClN2 |
| Molekylvekt |
196.6766 |
| InChI |
InChI=1/C10H13ClN2/c11-9-2-1-3-10(8-9)13-6-4-12-5-7-13/h1-3,8,12H,4-7H2 |
| CAS-nummer |
6640-24-0 |
| EINECS |
229-654-7 |
| Molecular Structure |
|
| Tetthet |
1.159g/cm3 |
| Smeltepunkt |
210-214℃ |
| Kokepunkt |
336.4°C at 760 mmHg |
| Brytningsindeks |
1.557 |
| Flammepunktet |
157.2°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
