produktnavn |
2-Bromo-4,6-dichloroaniline |
Synonymer |
2-bromo-1-(4-cyclohexylphenyl)ethanone; Benzenamine, 2-bromo-4,6-dichloro- |
Molekylær Formel |
C6H4BrCl2N |
Molekylvekt |
240.9127 |
InChI |
InChI=1/C6H4BrCl2N/c7-4-1-3(8)2-5(9)6(4)10/h1-2H,10H2 |
CAS-nummer |
697-86-9 |
Molecular Structure |
|
Tetthet |
1.827g/cm3 |
Kokepunkt |
273°C at 760 mmHg |
Brytningsindeks |
1.648 |
Flammepunktet |
121.8°C |
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
Sikkerhet Beskrivelse |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|