| produktnavn |
4-Borono-L-phenylalanine |
| Synonymer |
4-Boronophenylalanine; 10B-Bpa; para-Borono-L-phenylalanine; para-Boronophenylalanine; L-Phenylalanine, 4-borono-; 4-(dihydroxyboranyl)phenylalanine; 4-(dihydroxyboranyl)-L-phenylalanine |
| Molekylær Formel |
C9H12BNO4 |
| Molekylvekt |
209.0069 |
| InChI |
InChI=1/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)/t8-/m0/s1 |
| CAS-nummer |
76410-58-7 |
| Molecular Structure |
|
| Tetthet |
1.34g/cm3 |
| Kokepunkt |
449.3°C at 760 mmHg |
| Brytningsindeks |
1.59 |
| Flammepunktet |
225.5°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
