| produktnavn |
2,6-Dimethylquinoline |
| Synonymer |
6-METHYLQUINALDINE; 2,6-dimethyl-quinolin; P-TOLUQUINALDINE; Quinoline, 2,6-dimethyl- |
| Molekylær Formel |
C11H11N |
| Molekylvekt |
157.2117 |
| InChI |
InChI=1/C11H11N/c1-8-3-6-11-10(7-8)5-4-9(2)12-11/h3-7H,1-2H3 |
| CAS-nummer |
877-43-0 |
| EINECS |
212-891-5 |
| Molecular Structure |
|
| Tetthet |
1.052g/cm3 |
| Smeltepunkt |
56-60 °C |
| Kokepunkt |
266.5°C at 760 mmHg |
| Brytningsindeks |
1.61 |
| Flammepunktet |
106.5°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
