Nazwa produktu: |
4-Borono-D-phenylalanine |
Synonimy |
4-(dihydroxyboranyl)-D-phenylalanine |
MF |
C9H12BNO4 |
Masie cząsteczkowej |
209.0069 |
InChI |
InChI=1/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)/t8-/m1/s1 |
Nr CAS |
111821-49-9 |
Struktury molekularnej |
|
Gęstość |
1.34g/cm3 |
Temperatura wrzenia |
449.3°C at 760 mmHg |
Współczynnik załamania |
1.59 |
Temperatura zapłonu |
225.5°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|