Nazwa produktu: |
5-chloro-2-hydroxybenzonitrile |
MF |
C7H4ClNO |
Masie cząsteczkowej |
153.5658 |
InChI |
InChI=1/C7H4ClNO/c8-6-1-2-7(10)5(3-6)4-9/h1-3,10H |
Nr CAS |
13589-72-5 |
Struktury molekularnej |
|
Gęstość |
1.41g/cm3 |
Temperatura topnienia |
152℃ |
Temperatura wrzenia |
269.4°C at 760 mmHg |
Współczynnik załamania |
1.611 |
Temperatura zapłonu |
116.7°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|