Nazwa produktu: |
5-Bromo-2,3-difluorophenol |
Synonimy |
Bromodifluorophenol5; 3-Bromo-5,6-difluorophenol; 2,3-difluoro-5-bromophenol; bis[3-(trifluoromethyl)phenyl]methanone |
MF |
C6H3BrF2O |
Masie cząsteczkowej |
208.9882 |
InChI |
InChI=1/C6H3BrF2O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
Nr CAS |
186590-26-1 |
Struktury molekularnej |
|
Gęstość |
1.858g/cm3 |
Temperatura wrzenia |
212.2°C at 760 mmHg |
Współczynnik załamania |
1.549 |
Temperatura zapłonu |
82.1°C |
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|