Nazwa produktu: |
(S)-1,2,3,4-Tetrahydro-2-naphthylamine |
Synonimy |
(S)-2-Amino-1,2,3,4-tetrahydronaphthalene; (S)-1-Aminotetraline; (S)-2-Aminotetralin; (1S)-1,2,3,4-tetrahydronaphthalen-1-amine; (2S)-1,2,3,4-tetrahydronaphthalen-2-amine |
MF |
C10H13N |
Masie cząsteczkowej |
147.2169 |
InChI |
InChI=1/C10H13N/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-4,10H,5-7,11H2/t10-/m0/s1 |
Nr CAS |
21880-87-5 |
Struktury molekularnej |
|
Gęstość |
1.024g/cm3 |
Temperatura wrzenia |
250.665°C at 760 mmHg |
Współczynnik załamania |
1.561 |
Temperatura zapłonu |
111.607°C |
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|