Nazwa produktu: |
2-Bromo-5-fluoronitrobenzene |
Synonimy |
1-Bromo-4-fluoro-2-nitrobenzene |
MF |
C6H3BrFNO2 |
Masie cząsteczkowej |
219.9959 |
InChI |
InChI=1/C6H3BrFNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
Nr CAS |
446-09-3 |
EINECS |
207-160-2 |
Struktury molekularnej |
|
Gęstość |
1.808g/cm3 |
Temperatura topnienia |
37-39℃ |
Temperatura wrzenia |
220.9°C at 760 mmHg |
Współczynnik załamania |
1.579 |
Temperatura zapłonu |
87.4°C |
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|