| Nazwa produktu: |
lupinine |
| Synonimy |
(-)-Lupinine; (1R-trans)-Octahydro-2H-quinolizine-1-methanol; (1R,9aR)-octahydro-2H-quinolizin-1-ylmethanol; (1S,9aR)-octahydro-2H-quinolizin-1-ylmethanol |
| MF |
C10H19NO |
| Masie cząsteczkowej |
169.264 |
| InChI |
InChI=1/C10H19NO/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2/t9-,10-/m1/s1 |
| Nr CAS |
486-70-4 |
| EINECS |
207-638-0 |
| Struktury molekularnej |
|
| Gęstość |
1.04g/cm3 |
| Temperatura topnienia |
68-69℃ |
| Temperatura wrzenia |
270°C at 760 mmHg |
| Współczynnik załamania |
1.525 |
| Temperatura zapłonu |
99.1°C |
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
