Nazwa produktu: |
D-Ethionine |
Synonimy |
D-2-Amino-4-(ethylthio)butyric acid; S-ethyl-D-homocysteine |
MF |
C6H13NO2S |
Masie cząsteczkowej |
163.2379 |
InChI |
InChI=1/C6H13NO2S/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1 |
Nr CAS |
535-32-0 |
EINECS |
208-612-1 |
Struktury molekularnej |
|
Gęstość |
1.164g/cm3 |
Temperatura topnienia |
278℃ |
Temperatura wrzenia |
310.4°C at 760 mmHg |
Współczynnik załamania |
1.523 |
Temperatura zapłonu |
141.5°C |
Kody ryzyka |
R40:Possible risks of irreversible effects.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|