Nazwa produktu: |
4-Heptanol |
Synonimy |
Dipropylcarbinol; heptan-4-ol |
MF |
C7H16O |
Masie cząsteczkowej |
116.2013 |
InChI |
InChI=1/C7H16O/c1-3-5-7(8)6-4-2/h7-8H,3-6H2,1-2H3 |
Nr CAS |
589-55-9 |
EINECS |
209-651-7 |
Struktury molekularnej |
|
Gęstość |
0.818g/cm3 |
Temperatura wrzenia |
161.3°C at 760 mmHg |
Współczynnik załamania |
1.42 |
Temperatura zapłonu |
61.8°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R10:Flammable.;
R36:Irritating to eyes.;
|
Bezpieczeństwo opis |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|