| Nazwa produktu: |
1,2,4,5-Tetrabromobenzene |
| Synonimy |
2,3,5,6-Tetrabromobenzene; NSC 27002; Benzene, 1,2,4,5-tetrabromo- |
| MF |
C6H2Br4 |
| Masie cząsteczkowej |
393.6961 |
| InChI |
InChI=1/C6H2Br4/c7-3-1-4(8)6(10)2-5(3)9/h1-2H |
| Nr CAS |
636-28-2 |
| EINECS |
211-253-3 |
| Struktury molekularnej |
|
| Gęstość |
2.553g/cm3 |
| Temperatura topnienia |
180-182℃ |
| Temperatura wrzenia |
327.5°C at 760 mmHg |
| Współczynnik załamania |
1.661 |
| Temperatura zapłonu |
148.5°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
