Nazwa produktu: |
(S)-3-Amino-3-phenylpropan-1-ol |
Synonimy |
(S)-1-Phenyl-3-propanolamine; (S)-3-Amino-3-phenylpropi-1-ol; (S)-3-Amino-3-phenylpropan-l-ol; (3S)-3-amino-3-phenyl-propan-1-ol hydrochloride |
MF |
C9H14ClNO |
Masie cząsteczkowej |
187.6666 |
InChI |
InChI=1/C9H13NO.ClH/c10-9(6-7-11)8-4-2-1-3-5-8;/h1-5,9,11H,6-7,10H2;1H/t9-;/m0./s1 |
Nr CAS |
82769-76-4 |
Struktury molekularnej |
|
Temperatura wrzenia |
325.3°C at 760 mmHg |
Temperatura zapłonu |
150.5°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|