Nazwa produktu: |
2-Amino-3,5-dibromo-6-methylpyridine |
Synonimy |
3,5-Dibromo-6-methylpyridin-2-amine; 2-amino-3,5-dibromo-6-methylpyridinium |
MF |
C6H7Br2N2 |
Masie cząsteczkowej |
266.9406 |
InChI |
InChI=1/C6H6Br2N2/c1-3-4(7)2-5(8)6(9)10-3/h2H,1H3,(H2,9,10)/p+1 |
Nr CAS |
91872-10-5 |
Struktury molekularnej |
|
Temperatura topnienia |
144℃ |
Temperatura wrzenia |
261.6°C at 760 mmHg |
Temperatura zapłonu |
112°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|