Nome do produto |
5,7-Dimethoxyflavanone |
Sinônimos |
Pinocembrin dimethyl ether; 5,7-dimethoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
Fórmula molecular |
C17H16O4 |
Peso Molecular |
284.3065 |
InChI |
InChI=1/C17H16O4/c1-19-12-8-15(20-2)17-13(18)10-14(21-16(17)9-12)11-6-4-3-5-7-11/h3-9,14H,10H2,1-2H3 |
CAS Registry Number |
1036-72-2 |
Estrutura Molecular |
|
Densidade |
1.204g/cm3 |
Ponto de ebulição |
468.8°C at 760 mmHg |
índice de refração |
1.574 |
O ponto de inflamação |
209.4°C |
Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|