| Nome do produto |
2-Ethoxy-p-cresol |
| Sinônimos |
2-Ethoxy-p-cresol (OH=1); 2-Ethoxy-4-methylphenol |
| Fórmula molecular |
C9H12O2 |
| Peso Molecular |
152.1904 |
| InChI |
InChI=1/C9H12O2/c1-3-11-9-6-7(2)4-5-8(9)10/h4-6,10H,3H2,1-2H3 |
| CAS Registry Number |
2563-07-7 |
| Estrutura Molecular |
|
| Densidade |
1.052g/cm3 |
| Ponto de ebulição |
243.7°C at 760 mmHg |
| índice de refração |
1.524 |
| O ponto de inflamação |
105°C |
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
