| Nome do produto |
Bromoethylbiphenyl |
| Sinônimos |
4-Bromoethylbiphenyl; 4-(Bromomethyl)biphenyl; 4-Phenylbenzyl bromide |
| Fórmula molecular |
C13H11Br |
| Peso Molecular |
247.1304 |
| InChI |
InChI=1/C13H11Br/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2 |
| CAS Registry Number |
2567-29-5 |
| Estrutura Molecular |
|
| Densidade |
1.341g/cm3 |
| Ponto de fusão |
86℃ |
| Ponto de ebulição |
333.4°C at 760 mmHg |
| Ãndice de refração |
1.605 |
| O ponto de inflamação |
161.3°C |
| SÃmbolos de perigo |
 Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
