| Nome do produto |
3-Bromo-2,4,5,6-tetrafluorobenzoylchloride |
| Sinônimos |
3-Bromo-2,4,5,6-tetrafluorobenzoyl chloride |
| Fórmula molecular |
C7BrClF4O |
| Peso Molecular |
291.4249 |
| InChI |
InChI=1/C7BrClF4O/c8-2-3(10)1(7(9)14)4(11)6(13)5(2)12 |
| CAS Registry Number |
292621-46-6 |
| Estrutura Molecular |
|
| Densidade |
1.957g/cm3 |
| Ponto de ebulição |
206.8°C at 760 mmHg |
| índice de refração |
1.505 |
| O ponto de inflamação |
78.9°C |
| Códigos de risco |
R34:Causes burns.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
