| Nome do produto |
2,3-Dimethoxybenzaldoxime |
| Sinônimos |
o-Veratraldehyde, oxime; 2-08-00-00269 (Beilstein Handbook Reference); AI3-03770; BRN 1953084; Benzaldehyde, 2,3-dimethoxy-, oxime; 1-(2,3-dimethoxyphenyl)-N-hydroxymethanimine; 2,3-dimethoxybenzaldehyde oxime |
| Fórmula molecular |
C9H11NO3 |
| Peso Molecular |
181.1885 |
| InChI |
InChI=1/C9H11NO3/c1-12-8-5-3-4-7(6-10-11)9(8)13-2/h3-6,11H,1-2H3/b10-6+ |
| CAS Registry Number |
5470-95-1 |
| Estrutura Molecular |
|
| Densidade |
1.11g/cm3 |
| Ponto de ebulição |
293.1°C at 760 mmHg |
| índice de refração |
1.501 |
| O ponto de inflamação |
131.1°C |
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
