| Nome do produto |
4-Bromobenzhydrazide |
| Sinônimos |
4-Bromobenzoic hydrazide; 4-bromobenzohydrazide |
| Fórmula molecular |
C7H7BrN2O |
| Peso Molecular |
215.0473 |
| InChI |
InChI=1/C7H7BrN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| CAS Registry Number |
5933-32-4 |
| EINECS |
227-681-9 |
| Estrutura Molecular |
|
| Densidade |
1.615g/cm3 |
| Ponto de fusão |
165-167℃ |
| Ponto de ebulição |
353.2°C at 760 mmHg |
| índice de refração |
1.615 |
| O ponto de inflamação |
167.4°C |
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
