| Nome do produto |
4,5-Diphenyl-4-oxazoline-2-thione |
| Sinônimos |
4,5-Diphenyl-2-oxazolethiol; 4,5-Diphenyl-2-mercaptooxazole; 4,5-diphenyl-1,3-oxazole-2(3H)-thione |
| Fórmula molecular |
C15H11NOS |
| Peso Molecular |
253.3189 |
| InChI |
InChI=1/C15H11NOS/c18-15-16-13(11-7-3-1-4-8-11)14(17-15)12-9-5-2-6-10-12/h1-10H,(H,16,18) |
| CAS Registry Number |
6670-13-9 |
| EINECS |
229-707-4 |
| Estrutura Molecular |
|
| Densidade |
1.31g/cm3 |
| Ponto de fusão |
256-260℃ |
| Ponto de ebulição |
390.6°C at 760 mmHg |
| índice de refração |
1.708 |
| O ponto de inflamação |
190.1°C |
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
