اسم المنتج |
2-Chloro isonicotinamide |
الاسم المستعار |
6-methyl-5-nitropyridin-2(1H)-one; 2-chloropyridine-4-carboxamide |
الصيغة الجزيئية |
C6H5ClN2O |
الوزن الجزيئي الغرامي |
156.5697 |
InChI |
InChI=1/C6H5ClN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
إستراتيجية المساعدة القطرية |
100859-84-5 |
بنية جزيئية |
|
كثافة |
1.381g/cm3 |
درجة الإنصهار |
193℃ |
نقطة الغليان |
312.2°C at 760 mmHg |
معامل الإنكسار |
1.588 |
نقطة الوميض |
142.6°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|