| اسم المنتج |
1,2-Dimethoxy-4,5-dinitrobenzene |
| الاسم المستعار |
4,5-Dinitrocatechol dimethyl ether; 1,5-dimethoxy-2,4-dinitrobenzene; 1,5-dimethoxy-2,4dinitrobenzene; 1,5-dimethoxy-2,4dinitrobenzene; 1,5-Dimethoxy-2,4-dinitrobenzene |
| الصيغة الجزيئية |
C8H8N2O6 |
| الوزن الجزيئي الغرامي |
228.1589 |
| InChI |
InChI=1/C8H8N2O6/c1-15-7-3-5(9(11)12)6(10(13)14)4-8(7)16-2/h3-4H,1-2H3 |
| إستراتيجية المساعدة القطرية |
3395-03-7;1210-96-4 |
| بنية جزيئية |
|
| كثافة |
1.416g/cm3 |
| نقطة الغليان |
410.4°C at 760 mmHg |
| معامل الإنكسار |
1.567 |
| نقطة الوميض |
205.7°C |
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R5:Heating may cause an explosion.;
|
| شروط الأمن |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
